C14H23Cl — CID 135050721
cis-(1S,2S)-1-[(E)-4-chlorobut-2-enyl]-2-ethenyl-1,3,3-trimethylcyclopentane (PubChem CID 135050721) has the molecular formula C14H23Cl and a molecular weight of 226.79 g/mol. Its IUPAC name is cis-(1S,2S)-1-[(E)-4-chlorobut-2-enyl]-2-ethenyl-1,3,3-trimethylcyclopentane.
| Compound Name | cis-(1S,2S)-1-[(E)-4-chlorobut-2-enyl]-2-ethenyl-1,3,3-trimethylcyclopentane |
|---|---|
| PubChem CID | 135050721 |
| Molecular Formula | C14H23Cl |
| Molecular Weight | 226.79 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | cis-(1S,2S)-1-[(E)-4-chlorobut-2-enyl]-2-ethenyl-1,3,3-trimethylcyclopentane |
| SMILES | C=C[C@H]1C(C)(C)CC[C@@]1(C)C/C=C/CCl |
| InChI | InChI=1S/C14H23Cl/c1-5-12-13(2,3)9-10-14(12,4)8-6-7-11-15/h5-7,12H,1,8-11H2,2-4H3/b7-6+/t12-,14+/m0/s1 |
| InChIKey | ZUOQNLDRXGQAGI-XFUXEANSSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.79 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|