About 2,5-dimethyl-4-phenyl-5-phenyltellurinyl-4H-1,3-oxazole
2,5-dimethyl-4-phenyl-5-phenyltellurinyl-4H-1,3-oxazole (PubChem CID 135050813) has the molecular formula C17H17NO2Te
and a molecular weight of 394.93 g/mol. Its IUPAC name is 2,5-dimethyl-4-phenyl-5-phenyltellurinyl-4H-1,3-oxazole.
Molecular Properties
| Compound Name | 2,5-dimethyl-4-phenyl-5-phenyltellurinyl-4H-1,3-oxazole |
| PubChem CID | 135050813 |
| Molecular Formula | C17H17NO2Te |
| Molecular Weight | 394.93 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | 2,5-dimethyl-4-phenyl-5-phenyltellurinyl-4H-1,3-oxazole |
| SMILES | CC1=NC(c2ccccc2)C(C)([Te](=O)c2ccccc2)O1 |
| InChI | InChI=1S/C17H17NO2Te/c1-13-18-16(14-9-5-3-6-10-14)17(2,20-13)21(19)15-11-7-4-8-12-15/h3-12,16H,1-2H3 |
| InChIKey | MUIQMUGZPDQSPG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.93 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dimethyl-4-phenyl-5-phenyltellurinyl-4H-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-4-phenyl-5-phenyltellurinyl-4H-1,3-oxazole?
The IUPAC name of 2,5-dimethyl-4-phenyl-5-phenyltellurinyl-4H-1,3-oxazole (CID 135050813) is 2,5-dimethyl-4-phenyl-5-phenyltellurinyl-4H-1,3-oxazole.
What is the SMILES notation for 2,5-dimethyl-4-phenyl-5-phenyltellurinyl-4H-1,3-oxazole?
The canonical SMILES for 2,5-dimethyl-4-phenyl-5-phenyltellurinyl-4H-1,3-oxazole is CC1=NC(c2ccccc2)C(C)([Te](=O)c2ccccc2)O1.
What is the InChIKey of 2,5-dimethyl-4-phenyl-5-phenyltellurinyl-4H-1,3-oxazole?
The InChIKey is MUIQMUGZPDQSPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO2Te/c1-13-18-16(14-9-5-3-6-10-14)17(2,20-13)21(19)15-11-7-4-8-12-15/h3-12,16H,1-2H3.
What are the key properties of 2,5-dimethyl-4-phenyl-5-phenyltellurinyl-4H-1,3-oxazole?
2,5-dimethyl-4-phenyl-5-phenyltellurinyl-4H-1,3-oxazole has a molecular weight of 394.93 g/mol, XLogP of 2.80, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-4-phenyl-5-phenyltellurinyl-4H-1,3-oxazole is sourced from PubChem (CID 135050813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).