C19H31NO2Si — CID 135051126
2-[1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-3-methoxy-N-prop-2-enylaniline (PubChem CID 135051126) has the molecular formula C19H31NO2Si and a molecular weight of 333.55 g/mol. Its IUPAC name is 2-[1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-3-methoxy-N-prop-2-enylaniline.
| Compound Name | 2-[1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-3-methoxy-N-prop-2-enylaniline |
|---|---|
| PubChem CID | 135051126 |
| Molecular Formula | C19H31NO2Si |
| Molecular Weight | 333.55 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | 2-[1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-3-methoxy-N-prop-2-enylaniline |
| SMILES | C=CCNc1cccc(OC)c1C(C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H31NO2Si/c1-9-14-20-15-12-11-13-17(21-6)18(15)16(10-2)22-23(7,8)19(3,4)5/h9-13,16,20H,1-2,14H2,3-8H3 |
| InChIKey | PUNXEFXYKSIHAQ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.55 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|