About [6-bromo-5-(2-bromo-3,6-dimethylphenyl)hexoxy]-tri(propan-2-yl)silane
[6-bromo-5-(2-bromo-3,6-dimethylphenyl)hexoxy]-tri(propan-2-yl)silane (PubChem CID 135051220) has the molecular formula C23H40Br2OSi
and a molecular weight of 520.47 g/mol. Its IUPAC name is [6-bromo-5-(2-bromo-3,6-dimethylphenyl)hexoxy]-tri(propan-2-yl)silane.
Molecular Properties
| Compound Name | [6-bromo-5-(2-bromo-3,6-dimethylphenyl)hexoxy]-tri(propan-2-yl)silane |
| PubChem CID | 135051220 |
| Molecular Formula | C23H40Br2OSi |
| Molecular Weight | 520.47 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | [6-bromo-5-(2-bromo-3,6-dimethylphenyl)hexoxy]-tri(propan-2-yl)silane |
| SMILES | Cc1ccc(C)c(C(CBr)CCCCO[Si](C(C)C)(C(C)C)C(C)C)c1Br |
| InChI | InChI=1S/C23H40Br2OSi/c1-16(2)27(17(3)4,18(5)6)26-14-10-9-11-21(15-24)22-19(7)12-13-20(8)23(22)25/h12-13,16-18,21H,9-11,14-15H2,1-8H3 |
| InChIKey | QOQSTMHPDIFAOQ-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 520.47 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [6-bromo-5-(2-bromo-3,6-dimethylphenyl)hexoxy]-tri(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-bromo-5-(2-bromo-3,6-dimethylphenyl)hexoxy]-tri(propan-2-yl)silane?
The IUPAC name of [6-bromo-5-(2-bromo-3,6-dimethylphenyl)hexoxy]-tri(propan-2-yl)silane (CID 135051220) is [6-bromo-5-(2-bromo-3,6-dimethylphenyl)hexoxy]-tri(propan-2-yl)silane.
What is the SMILES notation for [6-bromo-5-(2-bromo-3,6-dimethylphenyl)hexoxy]-tri(propan-2-yl)silane?
The canonical SMILES for [6-bromo-5-(2-bromo-3,6-dimethylphenyl)hexoxy]-tri(propan-2-yl)silane is Cc1ccc(C)c(C(CBr)CCCCO[Si](C(C)C)(C(C)C)C(C)C)c1Br.
What is the InChIKey of [6-bromo-5-(2-bromo-3,6-dimethylphenyl)hexoxy]-tri(propan-2-yl)silane?
The InChIKey is QOQSTMHPDIFAOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H40Br2OSi/c1-16(2)27(17(3)4,18(5)6)26-14-10-9-11-21(15-24)22-19(7)12-13-20(8)23(22)25/h12-13,16-18,21H,9-11,14-15H2,1-8H3.
What are the key properties of [6-bromo-5-(2-bromo-3,6-dimethylphenyl)hexoxy]-tri(propan-2-yl)silane?
[6-bromo-5-(2-bromo-3,6-dimethylphenyl)hexoxy]-tri(propan-2-yl)silane has a molecular weight of 520.47 g/mol, XLogP of 8.91, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [6-bromo-5-(2-bromo-3,6-dimethylphenyl)hexoxy]-tri(propan-2-yl)silane is sourced from PubChem (CID 135051220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).