About dimethyl-[(3-methyl-5,6-dihydro-4H-1,2-benzodiselenol-7-yl)methylidene]azanium
dimethyl-[(3-methyl-5,6-dihydro-4H-1,2-benzodiselenol-7-yl)methylidene]azanium (PubChem CID 135051356) has the molecular formula C11H16NSe2+
and a molecular weight of 320.18 g/mol. Its IUPAC name is dimethyl-[(3-methyl-5,6-dihydro-4H-1,2-benzodiselenol-7-yl)methylidene]azanium.
Molecular Properties
| Compound Name | dimethyl-[(3-methyl-5,6-dihydro-4H-1,2-benzodiselenol-7-yl)methylidene]azanium |
| PubChem CID | 135051356 |
| Molecular Formula | C11H16NSe2+ |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 321.96 |
| IUPAC Name | dimethyl-[(3-methyl-5,6-dihydro-4H-1,2-benzodiselenol-7-yl)methylidene]azanium |
| SMILES | CC1=C2CCCC(C=[N+](C)C)=C2[Se][Se]1 |
| InChI | InChI=1S/C11H16NSe2/c1-8-10-6-4-5-9(7-12(2)3)11(10)14-13-8/h7H,4-6H2,1-3H3/q+1 |
| InChIKey | JEIFTUOKNVOTOZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-[(3-methyl-5,6-dihydro-4H-1,2-benzodiselenol-7-yl)methylidene]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-[(3-methyl-5,6-dihydro-4H-1,2-benzodiselenol-7-yl)methylidene]azanium?
The IUPAC name of dimethyl-[(3-methyl-5,6-dihydro-4H-1,2-benzodiselenol-7-yl)methylidene]azanium (CID 135051356) is dimethyl-[(3-methyl-5,6-dihydro-4H-1,2-benzodiselenol-7-yl)methylidene]azanium.
What is the SMILES notation for dimethyl-[(3-methyl-5,6-dihydro-4H-1,2-benzodiselenol-7-yl)methylidene]azanium?
The canonical SMILES for dimethyl-[(3-methyl-5,6-dihydro-4H-1,2-benzodiselenol-7-yl)methylidene]azanium is CC1=C2CCCC(C=[N+](C)C)=C2[Se][Se]1.
What is the InChIKey of dimethyl-[(3-methyl-5,6-dihydro-4H-1,2-benzodiselenol-7-yl)methylidene]azanium?
The InChIKey is JEIFTUOKNVOTOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16NSe2/c1-8-10-6-4-5-9(7-12(2)3)11(10)14-13-8/h7H,4-6H2,1-3H3/q+1.
What are the key properties of dimethyl-[(3-methyl-5,6-dihydro-4H-1,2-benzodiselenol-7-yl)methylidene]azanium?
dimethyl-[(3-methyl-5,6-dihydro-4H-1,2-benzodiselenol-7-yl)methylidene]azanium has a molecular weight of 320.18 g/mol, XLogP of 1.38, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-[(3-methyl-5,6-dihydro-4H-1,2-benzodiselenol-7-yl)methylidene]azanium is sourced from PubChem (CID 135051356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).