C16H18NSe2+ — CID 135051357
dimethyl-[(3-phenyl-5,6-dihydro-4H-1,2-benzodiselenol-7-yl)methylidene]azanium (PubChem CID 135051357) has the molecular formula C16H18NSe2+ and a molecular weight of 382.25 g/mol. Its IUPAC name is dimethyl-[(3-phenyl-5,6-dihydro-4H-1,2-benzodiselenol-7-yl)methylidene]azanium.
| Compound Name | dimethyl-[(3-phenyl-5,6-dihydro-4H-1,2-benzodiselenol-7-yl)methylidene]azanium |
|---|---|
| PubChem CID | 135051357 |
| Molecular Formula | C16H18NSe2+ |
| Molecular Weight | 382.25 g/mol |
| Exact Mass | 383.98 |
| IUPAC Name | dimethyl-[(3-phenyl-5,6-dihydro-4H-1,2-benzodiselenol-7-yl)methylidene]azanium |
| SMILES | C[N+](C)=CC1=C2[Se][Se]C(c3ccccc3)=C2CCC1 |
| InChI | InChI=1S/C16H18NSe2/c1-17(2)11-13-9-6-10-14-15(18-19-16(13)14)12-7-4-3-5-8-12/h3-5,7-8,11H,6,9-10H2,1-2H3/q+1 |
| InChIKey | QDYGULUXUUHJHN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|