About (E)-4-[2-[dibromo(methyl)-λ4-tellanyl]phenyl]but-3-en-2-one
(E)-4-[2-[dibromo(methyl)-λ4-tellanyl]phenyl]but-3-en-2-one (PubChem CID 135051631) has the molecular formula C11H12Br2OTe
and a molecular weight of 447.62 g/mol. Its IUPAC name is (E)-4-[2-[dibromo(methyl)-λ4-tellanyl]phenyl]but-3-en-2-one.
Molecular Properties
| Compound Name | (E)-4-[2-[dibromo(methyl)-λ4-tellanyl]phenyl]but-3-en-2-one |
| PubChem CID | 135051631 |
| Molecular Formula | C11H12Br2OTe |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.83 |
| IUPAC Name | (E)-4-[2-[dibromo(methyl)-λ4-tellanyl]phenyl]but-3-en-2-one |
| SMILES | CC(=O)/C=C/c1ccccc1[Te](C)(Br)Br |
| InChI | InChI=1S/C11H12Br2OTe/c1-9(14)7-8-10-5-3-4-6-11(10)15(2,12)13/h3-8H,1-2H3/b8-7+ |
| InChIKey | NPVGDYGKIMFWCW-BQYQJAHWSA-N |
| XLogP | 3.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-[2-[dibromo(methyl)-λ4-tellanyl]phenyl]but-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-[2-[dibromo(methyl)-λ4-tellanyl]phenyl]but-3-en-2-one?
The IUPAC name of (E)-4-[2-[dibromo(methyl)-λ4-tellanyl]phenyl]but-3-en-2-one (CID 135051631) is (E)-4-[2-[dibromo(methyl)-λ4-tellanyl]phenyl]but-3-en-2-one.
What is the SMILES notation for (E)-4-[2-[dibromo(methyl)-λ4-tellanyl]phenyl]but-3-en-2-one?
The canonical SMILES for (E)-4-[2-[dibromo(methyl)-λ4-tellanyl]phenyl]but-3-en-2-one is CC(=O)/C=C/c1ccccc1[Te](C)(Br)Br.
What is the InChIKey of (E)-4-[2-[dibromo(methyl)-λ4-tellanyl]phenyl]but-3-en-2-one?
The InChIKey is NPVGDYGKIMFWCW-BQYQJAHWSA-N. The full InChI is InChI=1S/C11H12Br2OTe/c1-9(14)7-8-10-5-3-4-6-11(10)15(2,12)13/h3-8H,1-2H3/b8-7+.
What are the key properties of (E)-4-[2-[dibromo(methyl)-λ4-tellanyl]phenyl]but-3-en-2-one?
(E)-4-[2-[dibromo(methyl)-λ4-tellanyl]phenyl]but-3-en-2-one has a molecular weight of 447.62 g/mol, XLogP of 3.36, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-[2-[dibromo(methyl)-λ4-tellanyl]phenyl]but-3-en-2-one is sourced from PubChem (CID 135051631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).