C19H24ClNO3S2 — CID 135051824
N-[2-chloro-6-(2-methoxy-1-propan-2-ylsulfanylethyl)phenyl]-4-methylbenzenesulfonamide (PubChem CID 135051824) has the molecular formula C19H24ClNO3S2 and a molecular weight of 413.99 g/mol. Its IUPAC name is N-[2-chloro-6-(2-methoxy-1-propan-2-ylsulfanylethyl)phenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-chloro-6-(2-methoxy-1-propan-2-ylsulfanylethyl)phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 135051824 |
| Molecular Formula | C19H24ClNO3S2 |
| Molecular Weight | 413.99 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | N-[2-chloro-6-(2-methoxy-1-propan-2-ylsulfanylethyl)phenyl]-4-methylbenzenesulfonamide |
| SMILES | COCC(SC(C)C)c1cccc(Cl)c1NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H24ClNO3S2/c1-13(2)25-18(12-24-4)16-6-5-7-17(20)19(16)21-26(22,23)15-10-8-14(3)9-11-15/h5-11,13,18,21H,12H2,1-4H3 |
| InChIKey | QUBNFOPHENKLDZ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.99 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |