C26H21NO3S — CID 135051835
(1R,8S,9S,13S)-1-ethylsulfanyl-8,11-diphenyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione (PubChem CID 135051835) has the molecular formula C26H21NO3S and a molecular weight of 427.53 g/mol. Its IUPAC name is (1R,8S,9S,13S)-1-ethylsulfanyl-8,11-diphenyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione.
| Compound Name | (1R,8S,9S,13S)-1-ethylsulfanyl-8,11-diphenyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione |
|---|---|
| PubChem CID | 135051835 |
| Molecular Formula | C26H21NO3S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | (1R,8S,9S,13S)-1-ethylsulfanyl-8,11-diphenyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione |
| SMILES | CCS[C@@]12O[C@@](c3ccccc3)(c3ccccc31)[C@H]1C(=O)N(c3ccccc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C26H21NO3S/c1-2-31-26-20-16-10-9-15-19(20)25(30-26,17-11-5-3-6-12-17)21-22(26)24(29)27(23(21)28)18-13-7-4-8-14-18/h3-16,21-22H,2H2,1H3/t21-,22+,25+,26+/m1/s1 |
| InChIKey | PVGDIMLIMWAWRG-HRHCJDDBSA-N |
| XLogP | 4.69 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|