C10H10N3O7- — CID 135052819
1-(2,4,6-trinitrocyclohexa-2,4-dien-1-yl)butan-2-one (PubChem CID 135052819) has the molecular formula C10H10N3O7- and a molecular weight of 284.20 g/mol. Its IUPAC name is 1-(2,4,6-trinitrocyclohexa-2,4-dien-1-yl)butan-2-one.
| Compound Name | 1-(2,4,6-trinitrocyclohexa-2,4-dien-1-yl)butan-2-one |
|---|---|
| PubChem CID | 135052819 |
| Molecular Formula | C10H10N3O7- |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 1-(2,4,6-trinitrocyclohexa-2,4-dien-1-yl)butan-2-one |
| SMILES | CCC(=O)CC1C([N+](=O)[O-])=CC([N+](=O)[O-])=C[C-]1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10N3O7/c1-2-7(14)5-8-9(12(17)18)3-6(11(15)16)4-10(8)13(19)20/h3-4,8H,2,5H2,1H3/q-1 |
| InChIKey | IACMWBFTICFJNI-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 146.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|