C14H10FNO6 — CID 135053235
dimethyl 1-(3-fluorophenyl)-4,5-dioxopyrrole-2,3-dicarboxylate (PubChem CID 135053235) has the molecular formula C14H10FNO6 and a molecular weight of 307.23 g/mol. Its IUPAC name is dimethyl 1-(3-fluorophenyl)-4,5-dioxopyrrole-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(3-fluorophenyl)-4,5-dioxopyrrole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 135053235 |
| Molecular Formula | C14H10FNO6 |
| Molecular Weight | 307.23 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | dimethyl 1-(3-fluorophenyl)-4,5-dioxopyrrole-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cccc(F)c2)C(=O)C1=O |
| InChI | InChI=1S/C14H10FNO6/c1-21-13(19)9-10(14(20)22-2)16(12(18)11(9)17)8-5-3-4-7(15)6-8/h3-6H,1-2H3 |
| InChIKey | RYCBKYLHJBAEAM-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.23 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_fives(89)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|