C11H7Cl4NOS — CID 135053267
(NZ)-N-[(2Z)-2,4,5,5-tetrachloro-3-phenylsulfanylpenta-2,4-dienylidene]hydroxylamine (PubChem CID 135053267) has the molecular formula C11H7Cl4NOS and a molecular weight of 343.06 g/mol. Its IUPAC name is (NZ)-N-[(2Z)-2,4,5,5-tetrachloro-3-phenylsulfanylpenta-2,4-dienylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(2Z)-2,4,5,5-tetrachloro-3-phenylsulfanylpenta-2,4-dienylidene]hydroxylamine |
|---|---|
| PubChem CID | 135053267 |
| Molecular Formula | C11H7Cl4NOS |
| Molecular Weight | 343.06 g/mol |
| Exact Mass | 340.90 |
| IUPAC Name | (NZ)-N-[(2Z)-2,4,5,5-tetrachloro-3-phenylsulfanylpenta-2,4-dienylidene]hydroxylamine |
| SMILES | O/N=C\C(Cl)=C(\Sc1ccccc1)C(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C11H7Cl4NOS/c12-8(6-16-17)10(9(13)11(14)15)18-7-4-2-1-3-5-7/h1-6,17H/b10-8-,16-6- |
| InChIKey | UWYSVJYNWPNNOM-QVPNEAHOSA-N |
| XLogP | 5.57 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.06 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|