C18H10F5NO2 — CID 135053268
[(Z)-[(2E)-1-phenylpenta-2,4-dienylidene]amino] 2,3,4,5,6-pentafluorobenzoate (PubChem CID 135053268) has the molecular formula C18H10F5NO2 and a molecular weight of 367.27 g/mol. Its IUPAC name is [(Z)-[(2E)-1-phenylpenta-2,4-dienylidene]amino] 2,3,4,5,6-pentafluorobenzoate.
| Compound Name | [(Z)-[(2E)-1-phenylpenta-2,4-dienylidene]amino] 2,3,4,5,6-pentafluorobenzoate |
|---|---|
| PubChem CID | 135053268 |
| Molecular Formula | C18H10F5NO2 |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | [(Z)-[(2E)-1-phenylpenta-2,4-dienylidene]amino] 2,3,4,5,6-pentafluorobenzoate |
| SMILES | C=C/C=C/C(=N/OC(=O)c1c(F)c(F)c(F)c(F)c1F)c1ccccc1 |
| InChI | InChI=1S/C18H10F5NO2/c1-2-3-9-11(10-7-5-4-6-8-10)24-26-18(25)12-13(19)15(21)17(23)16(22)14(12)20/h2-9H,1H2/b9-3+,24-11- |
| InChIKey | SVUAMVCWIXSOOO-LJWQXEGUSA-N |
| XLogP | 4.69 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|