About 1-oxo-3,6-dihydro-2H-thiopyran-3-ol
1-oxo-3,6-dihydro-2H-thiopyran-3-ol (PubChem CID 135053277) has the molecular formula C5H8O2S
and a molecular weight of 132.18 g/mol. Its IUPAC name is 1-oxo-3,6-dihydro-2H-thiopyran-3-ol.
Molecular Properties
| Compound Name | 1-oxo-3,6-dihydro-2H-thiopyran-3-ol |
| PubChem CID | 135053277 |
| Molecular Formula | C5H8O2S |
| Molecular Weight | 132.18 g/mol |
| Exact Mass | 132.02 |
| IUPAC Name | 1-oxo-3,6-dihydro-2H-thiopyran-3-ol |
| SMILES | O=S1CC=CC(O)C1 |
| InChI | InChI=1S/C5H8O2S/c6-5-2-1-3-8(7)4-5/h1-2,5-6H,3-4H2 |
| InChIKey | BLOGWVMUXMNKDU-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.18 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-oxo-3,6-dihydro-2H-thiopyran-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxo-3,6-dihydro-2H-thiopyran-3-ol?
The IUPAC name of 1-oxo-3,6-dihydro-2H-thiopyran-3-ol (CID 135053277) is 1-oxo-3,6-dihydro-2H-thiopyran-3-ol.
What is the SMILES notation for 1-oxo-3,6-dihydro-2H-thiopyran-3-ol?
The canonical SMILES for 1-oxo-3,6-dihydro-2H-thiopyran-3-ol is O=S1CC=CC(O)C1.
What is the InChIKey of 1-oxo-3,6-dihydro-2H-thiopyran-3-ol?
The InChIKey is BLOGWVMUXMNKDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2S/c6-5-2-1-3-8(7)4-5/h1-2,5-6H,3-4H2.
What are the key properties of 1-oxo-3,6-dihydro-2H-thiopyran-3-ol?
1-oxo-3,6-dihydro-2H-thiopyran-3-ol has a molecular weight of 132.18 g/mol, XLogP of -0.33, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxo-3,6-dihydro-2H-thiopyran-3-ol is sourced from PubChem (CID 135053277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).