C24H32N2O4Se2 — CID 135053285
2-[[2-(diethylcarbamoyl)-5-methoxyphenyl]diselanyl]-N,N-diethyl-4-methoxybenzamide (PubChem CID 135053285) has the molecular formula C24H32N2O4Se2 and a molecular weight of 570.45 g/mol. Its IUPAC name is 2-[[2-(diethylcarbamoyl)-5-methoxyphenyl]diselanyl]-N,N-diethyl-4-methoxybenzamide.
| Compound Name | 2-[[2-(diethylcarbamoyl)-5-methoxyphenyl]diselanyl]-N,N-diethyl-4-methoxybenzamide |
|---|---|
| PubChem CID | 135053285 |
| Molecular Formula | C24H32N2O4Se2 |
| Molecular Weight | 570.45 g/mol |
| Exact Mass | 572.07 |
| IUPAC Name | 2-[[2-(diethylcarbamoyl)-5-methoxyphenyl]diselanyl]-N,N-diethyl-4-methoxybenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(OC)cc1[Se][Se]c1cc(OC)ccc1C(=O)N(CC)CC |
| InChI | InChI=1S/C24H32N2O4Se2/c1-7-25(8-2)23(27)19-13-11-17(29-5)15-21(19)31-32-22-16-18(30-6)12-14-20(22)24(28)26(9-3)10-4/h11-16H,7-10H2,1-6H3 |
| InChIKey | IMSAHOOADGDOLE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.45 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|