C18H30O4Si — CID 135053320
ethyl (2Z,3E,5E)-7-[tert-butyl(dimethyl)silyl]oxy-6-methyl-2-(2-oxoethylidene)hepta-3,5-dienoate (PubChem CID 135053320) has the molecular formula C18H30O4Si and a molecular weight of 338.52 g/mol. Its IUPAC name is ethyl (2Z,3E,5E)-7-[tert-butyl(dimethyl)silyl]oxy-6-methyl-2-(2-oxoethylidene)hepta-3,5-dienoate.
| Compound Name | ethyl (2Z,3E,5E)-7-[tert-butyl(dimethyl)silyl]oxy-6-methyl-2-(2-oxoethylidene)hepta-3,5-dienoate |
|---|---|
| PubChem CID | 135053320 |
| Molecular Formula | C18H30O4Si |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | ethyl (2Z,3E,5E)-7-[tert-butyl(dimethyl)silyl]oxy-6-methyl-2-(2-oxoethylidene)hepta-3,5-dienoate |
| SMILES | CCOC(=O)C(=C\C=O)/C=C/C=C(\C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H30O4Si/c1-8-21-17(20)16(12-13-19)11-9-10-15(2)14-22-23(6,7)18(3,4)5/h9-13H,8,14H2,1-7H3/b11-9+,15-10+,16-12- |
| InChIKey | GEBRQCFSMJBPAX-YPMROBJJSA-N |
| XLogP | 4.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|