C27H44BrF3N4Si2 — CID 135053493
2-bromo-1,3-ditert-butyl-2-[1,3-ditert-butyl-2-[4-(trifluoromethyl)phenyl]-1,3,2-diazasilol-2-yl]-1,3,2-diazasilole (PubChem CID 135053493) has the molecular formula C27H44BrF3N4Si2 and a molecular weight of 617.75 g/mol. Its IUPAC name is 2-bromo-1,3-ditert-butyl-2-[1,3-ditert-butyl-2-[4-(trifluoromethyl)phenyl]-1,3,2-diazasilol-2-yl]-1,3,2-diazasilole.
| Compound Name | 2-bromo-1,3-ditert-butyl-2-[1,3-ditert-butyl-2-[4-(trifluoromethyl)phenyl]-1,3,2-diazasilol-2-yl]-1,3,2-diazasilole |
|---|---|
| PubChem CID | 135053493 |
| Molecular Formula | C27H44BrF3N4Si2 |
| Molecular Weight | 617.75 g/mol |
| Exact Mass | 616.22 |
| IUPAC Name | 2-bromo-1,3-ditert-butyl-2-[1,3-ditert-butyl-2-[4-(trifluoromethyl)phenyl]-1,3,2-diazasilol-2-yl]-1,3,2-diazasilole |
| SMILES | CC(C)(C)N1C=CN(C(C)(C)C)[Si]1(Br)[Si]1(c2ccc(C(F)(F)F)cc2)N(C(C)(C)C)C=CN1C(C)(C)C |
| InChI | InChI=1S/C27H44BrF3N4Si2/c1-23(2,3)32-17-18-33(24(4,5)6)36(32,22-15-13-21(14-16-22)27(29,30)31)37(28)34(25(7,8)9)19-20-35(37)26(10,11)12/h13-20H,1-12H3 |
| InChIKey | HWYKNXYURUYWPH-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.75 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|