About [2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-3-chloro-2-methylpropyl] acetate
[2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-3-chloro-2-methylpropyl] acetate (PubChem CID 135053689) has the molecular formula C13H22ClNO3
and a molecular weight of 275.78 g/mol. Its IUPAC name is [2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-3-chloro-2-methylpropyl] acetate.
Molecular Properties
| Compound Name | [2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-3-chloro-2-methylpropyl] acetate |
| PubChem CID | 135053689 |
| Molecular Formula | C13H22ClNO3 |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | [2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-3-chloro-2-methylpropyl] acetate |
| SMILES | CC(=O)OCC(C)(CCl)C1=N[C@H](C(C)(C)C)CO1 |
| InChI | InChI=1S/C13H22ClNO3/c1-9(16)18-8-13(5,7-14)11-15-10(6-17-11)12(2,3)4/h10H,6-8H2,1-5H3/t10-,13?/m0/s1 |
| InChIKey | HGODQXINFSJMQS-NKUHCKNESA-N |
| XLogP | 2.64 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-3-chloro-2-methylpropyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-3-chloro-2-methylpropyl] acetate?
The IUPAC name of [2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-3-chloro-2-methylpropyl] acetate (CID 135053689) is [2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-3-chloro-2-methylpropyl] acetate.
What is the SMILES notation for [2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-3-chloro-2-methylpropyl] acetate?
The canonical SMILES for [2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-3-chloro-2-methylpropyl] acetate is CC(=O)OCC(C)(CCl)C1=N[C@H](C(C)(C)C)CO1.
What is the InChIKey of [2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-3-chloro-2-methylpropyl] acetate?
The InChIKey is HGODQXINFSJMQS-NKUHCKNESA-N. The full InChI is InChI=1S/C13H22ClNO3/c1-9(16)18-8-13(5,7-14)11-15-10(6-17-11)12(2,3)4/h10H,6-8H2,1-5H3/t10-,13?/m0/s1.
What are the key properties of [2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-3-chloro-2-methylpropyl] acetate?
[2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-3-chloro-2-methylpropyl] acetate has a molecular weight of 275.78 g/mol, XLogP of 2.64, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-3-chloro-2-methylpropyl] acetate is sourced from PubChem (CID 135053689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).