C30H53BrN4Si2 — CID 135053722
2-bromo-1,3-ditert-butyl-2-[1,3-ditert-butyl-2-(4-tert-butylphenyl)-1,3,2-diazasilol-2-yl]-1,3,2-diazasilole (PubChem CID 135053722) has the molecular formula C30H53BrN4Si2 and a molecular weight of 605.86 g/mol. Its IUPAC name is 2-bromo-1,3-ditert-butyl-2-[1,3-ditert-butyl-2-(4-tert-butylphenyl)-1,3,2-diazasilol-2-yl]-1,3,2-diazasilole.
| Compound Name | 2-bromo-1,3-ditert-butyl-2-[1,3-ditert-butyl-2-(4-tert-butylphenyl)-1,3,2-diazasilol-2-yl]-1,3,2-diazasilole |
|---|---|
| PubChem CID | 135053722 |
| Molecular Formula | C30H53BrN4Si2 |
| Molecular Weight | 605.86 g/mol |
| Exact Mass | 604.30 |
| IUPAC Name | 2-bromo-1,3-ditert-butyl-2-[1,3-ditert-butyl-2-(4-tert-butylphenyl)-1,3,2-diazasilol-2-yl]-1,3,2-diazasilole |
| SMILES | CC(C)(C)c1ccc([Si]2([Si]3(Br)N(C(C)(C)C)C=CN3C(C)(C)C)N(C(C)(C)C)C=CN2C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H53BrN4Si2/c1-26(2,3)24-16-18-25(19-17-24)36(32(27(4,5)6)20-21-33(36)28(7,8)9)37(31)34(29(10,11)12)22-23-35(37)30(13,14)15/h16-23H,1-15H3 |
| InChIKey | PEYZFWZIPBFFOX-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.86 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|