C17H28O3 — CID 135053742
methyl 6-[(1S,3aS,6aS)-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]-2,2-dimethyl-6-oxohexanoate (PubChem CID 135053742) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is methyl 6-[(1S,3aS,6aS)-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]-2,2-dimethyl-6-oxohexanoate.
| Compound Name | methyl 6-[(1S,3aS,6aS)-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]-2,2-dimethyl-6-oxohexanoate |
|---|---|
| PubChem CID | 135053742 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | methyl 6-[(1S,3aS,6aS)-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]-2,2-dimethyl-6-oxohexanoate |
| SMILES | COC(=O)C(C)(C)CCCC(=O)[C@H]1CC[C@@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C17H28O3/c1-17(2,16(19)20-3)11-5-8-15(18)14-10-9-12-6-4-7-13(12)14/h12-14H,4-11H2,1-3H3/t12-,13-,14-/m0/s1 |
| InChIKey | IHDARNLEKNBSKX-IHRRRGAJSA-N |
| XLogP | 3.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |