C24H28O12 — CID 135053886
hexamethyl (8aS,8bS)-1,3,6,8,8a,8b-hexahydro-as-indacene-2,2,4,5,7,7-hexacarboxylate (PubChem CID 135053886) has the molecular formula C24H28O12 and a molecular weight of 508.48 g/mol. Its IUPAC name is hexamethyl (8aS,8bS)-1,3,6,8,8a,8b-hexahydro-as-indacene-2,2,4,5,7,7-hexacarboxylate.
| Compound Name | hexamethyl (8aS,8bS)-1,3,6,8,8a,8b-hexahydro-as-indacene-2,2,4,5,7,7-hexacarboxylate |
|---|---|
| PubChem CID | 135053886 |
| Molecular Formula | C24H28O12 |
| Molecular Weight | 508.48 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | hexamethyl (8aS,8bS)-1,3,6,8,8a,8b-hexahydro-as-indacene-2,2,4,5,7,7-hexacarboxylate |
| SMILES | COC(=O)C1=C2CC(C(=O)OC)(C(=O)OC)C[C@H]2[C@@H]2CC(C(=O)OC)(C(=O)OC)CC2=C1C(=O)OC |
| InChI | InChI=1S/C24H28O12/c1-31-17(25)15-13-9-23(19(27)33-3,20(28)34-4)7-11(13)12-8-24(21(29)35-5,22(30)36-6)10-14(12)16(15)18(26)32-2/h11-12H,7-10H2,1-6H3/t11-,12-/m0/s1 |
| InChIKey | ZAUQDZFAJBOVBU-RYUDHWBXSA-N |
| XLogP | 0.42 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.48 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|