C19H40O3Si — CID 135053940
(5R,6R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,2,6,8-tetramethylnonan-3-one (PubChem CID 135053940) has the molecular formula C19H40O3Si and a molecular weight of 344.61 g/mol. Its IUPAC name is (5R,6R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,2,6,8-tetramethylnonan-3-one.
| Compound Name | (5R,6R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,2,6,8-tetramethylnonan-3-one |
|---|---|
| PubChem CID | 135053940 |
| Molecular Formula | C19H40O3Si |
| Molecular Weight | 344.61 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | (5R,6R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,2,6,8-tetramethylnonan-3-one |
| SMILES | CC(C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H](O)CC(=O)C(C)(C)C |
| InChI | InChI=1S/C19H40O3Si/c1-13(2)17(22-23(10,11)19(7,8)9)14(3)15(20)12-16(21)18(4,5)6/h13-15,17,20H,12H2,1-11H3/t14-,15-,17-/m1/s1 |
| InChIKey | ZOKGMZAMDARXOQ-BFYDXBDKSA-N |
| XLogP | 5.04 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.61 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|