C16H17N — CID 135053975
6-methyl-2-phenyl-1,2,3,4-tetrahydroquinoline (PubChem CID 135053975) has the molecular formula C16H17N and a molecular weight of 223.32 g/mol. Its IUPAC name is 6-methyl-2-phenyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 6-methyl-2-phenyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 135053975 |
| Molecular Formula | C16H17N |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 6-methyl-2-phenyl-1,2,3,4-tetrahydroquinoline |
| SMILES | Cc1ccc2c(c1)CCC(c1ccccc1)N2 |
| InChI | InChI=1S/C16H17N/c1-12-7-9-16-14(11-12)8-10-15(17-16)13-5-3-2-4-6-13/h2-7,9,11,15,17H,8,10H2,1H3 |
| InChIKey | BYWUQSSQEANWKP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |