C27H33F3N2O4 — CID 135054049
tert-butyl N-benzyl-N-[(4S)-4-(4-methoxy-N-(2,2,2-trifluoroacetyl)anilino)hex-5-enyl]carbamate (PubChem CID 135054049) has the molecular formula C27H33F3N2O4 and a molecular weight of 506.57 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[(4S)-4-(4-methoxy-N-(2,2,2-trifluoroacetyl)anilino)hex-5-enyl]carbamate.
| Compound Name | tert-butyl N-benzyl-N-[(4S)-4-(4-methoxy-N-(2,2,2-trifluoroacetyl)anilino)hex-5-enyl]carbamate |
|---|---|
| PubChem CID | 135054049 |
| Molecular Formula | C27H33F3N2O4 |
| Molecular Weight | 506.57 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | tert-butyl N-benzyl-N-[(4S)-4-(4-methoxy-N-(2,2,2-trifluoroacetyl)anilino)hex-5-enyl]carbamate |
| SMILES | C=C[C@H](CCCN(Cc1ccccc1)C(=O)OC(C)(C)C)N(C(=O)C(F)(F)F)c1ccc(OC)cc1 |
| InChI | InChI=1S/C27H33F3N2O4/c1-6-21(32(24(33)27(28,29)30)22-14-16-23(35-5)17-15-22)13-10-18-31(25(34)36-26(2,3)4)19-20-11-8-7-9-12-20/h6-9,11-12,14-17,21H,1,10,13,18-19H2,2-5H3/t21-/m1/s1 |
| InChIKey | KBGXAARUBVFOMQ-OAQYLSRUSA-N |
| XLogP | 6.36 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.57 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|