C17H22ClNO3 — CID 135054133
tert-butyl N-[(Z,1R)-1-(4-chlorophenyl)-2-formylpent-2-enyl]carbamate (PubChem CID 135054133) has the molecular formula C17H22ClNO3 and a molecular weight of 323.82 g/mol. Its IUPAC name is tert-butyl N-[(Z,1R)-1-(4-chlorophenyl)-2-formylpent-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(Z,1R)-1-(4-chlorophenyl)-2-formylpent-2-enyl]carbamate |
|---|---|
| PubChem CID | 135054133 |
| Molecular Formula | C17H22ClNO3 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | tert-butyl N-[(Z,1R)-1-(4-chlorophenyl)-2-formylpent-2-enyl]carbamate |
| SMILES | CC/C=C(\C=O)[C@H](NC(=O)OC(C)(C)C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H22ClNO3/c1-5-6-13(11-20)15(12-7-9-14(18)10-8-12)19-16(21)22-17(2,3)4/h6-11,15H,5H2,1-4H3,(H,19,21)/b13-6+/t15-/m1/s1 |
| InChIKey | UDERSACFFBLJEL-MRHLJLSQSA-N |
| XLogP | 4.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|