C21H23F2NO3 — CID 135054175
tert-butyl (2S)-2-benzamido-3-(2,6-difluorophenyl)-2-methylpropanoate (PubChem CID 135054175) has the molecular formula C21H23F2NO3 and a molecular weight of 375.42 g/mol. Its IUPAC name is tert-butyl (2S)-2-benzamido-3-(2,6-difluorophenyl)-2-methylpropanoate.
| Compound Name | tert-butyl (2S)-2-benzamido-3-(2,6-difluorophenyl)-2-methylpropanoate |
|---|---|
| PubChem CID | 135054175 |
| Molecular Formula | C21H23F2NO3 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | tert-butyl (2S)-2-benzamido-3-(2,6-difluorophenyl)-2-methylpropanoate |
| SMILES | CC(C)(C)OC(=O)[C@](C)(Cc1c(F)cccc1F)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H23F2NO3/c1-20(2,3)27-19(26)21(4,13-15-16(22)11-8-12-17(15)23)24-18(25)14-9-6-5-7-10-14/h5-12H,13H2,1-4H3,(H,24,25)/t21-/m0/s1 |
| InChIKey | OPVYKICLQVQLHL-NRFANRHFSA-N |
| XLogP | 4.04 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |