C24H39NO5Si — CID 135054191
12-O-tert-butyl 9-O-methyl 10-[tert-butyl(dimethyl)silyl]oxy-12-azatricyclo[6.3.1.01,6]dodeca-6,9-diene-9,12-dicarboxylate (PubChem CID 135054191) has the molecular formula C24H39NO5Si and a molecular weight of 449.66 g/mol. Its IUPAC name is 12-O-tert-butyl 9-O-methyl 10-[tert-butyl(dimethyl)silyl]oxy-12-azatricyclo[6.3.1.01,6]dodeca-6,9-diene-9,12-dicarboxylate.
| Compound Name | 12-O-tert-butyl 9-O-methyl 10-[tert-butyl(dimethyl)silyl]oxy-12-azatricyclo[6.3.1.01,6]dodeca-6,9-diene-9,12-dicarboxylate |
|---|---|
| PubChem CID | 135054191 |
| Molecular Formula | C24H39NO5Si |
| Molecular Weight | 449.66 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | 12-O-tert-butyl 9-O-methyl 10-[tert-butyl(dimethyl)silyl]oxy-12-azatricyclo[6.3.1.01,6]dodeca-6,9-diene-9,12-dicarboxylate |
| SMILES | COC(=O)C1=C(O[Si](C)(C)C(C)(C)C)CC23CCCCC2=CC1N3C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H39NO5Si/c1-22(2,3)29-21(27)25-17-14-16-12-10-11-13-24(16,25)15-18(19(17)20(26)28-7)30-31(8,9)23(4,5)6/h14,17H,10-13,15H2,1-9H3 |
| InChIKey | QANKGFHTRVSANG-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.66 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|