C16H16O2 — CID 135054362
(3aS)-6-phenyl-3a-prop-2-enyl-3,4-dihydro-1H-cyclopenta[c]furan-5-one (PubChem CID 135054362) has the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. Its IUPAC name is (3aS)-6-phenyl-3a-prop-2-enyl-3,4-dihydro-1H-cyclopenta[c]furan-5-one.
| Compound Name | (3aS)-6-phenyl-3a-prop-2-enyl-3,4-dihydro-1H-cyclopenta[c]furan-5-one |
|---|---|
| PubChem CID | 135054362 |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | (3aS)-6-phenyl-3a-prop-2-enyl-3,4-dihydro-1H-cyclopenta[c]furan-5-one |
| SMILES | C=CC[C@@]12COCC1=C(c1ccccc1)C(=O)C2 |
| InChI | InChI=1S/C16H16O2/c1-2-8-16-9-14(17)15(13(16)10-18-11-16)12-6-4-3-5-7-12/h2-7H,1,8-11H2/t16-/m1/s1 |
| InChIKey | SSKHPUKZSQWLFP-MRXNPFEDSA-N |
| XLogP | 3.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|