C46H46O3S — CID 135054414
(2R,3R)-3-tert-butylsulfanyl-1,4-ditrityloxybutan-2-ol (PubChem CID 135054414) has the molecular formula C46H46O3S and a molecular weight of 678.94 g/mol. Its IUPAC name is (2R,3R)-3-tert-butylsulfanyl-1,4-ditrityloxybutan-2-ol.
| Compound Name | (2R,3R)-3-tert-butylsulfanyl-1,4-ditrityloxybutan-2-ol |
|---|---|
| PubChem CID | 135054414 |
| Molecular Formula | C46H46O3S |
| Molecular Weight | 678.94 g/mol |
| Exact Mass | 678.32 |
| IUPAC Name | (2R,3R)-3-tert-butylsulfanyl-1,4-ditrityloxybutan-2-ol |
| SMILES | CC(C)(C)S[C@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)[C@H](O)COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C46H46O3S/c1-44(2,3)50-43(35-49-46(39-28-16-7-17-29-39,40-30-18-8-19-31-40)41-32-20-9-21-33-41)42(47)34-48-45(36-22-10-4-11-23-36,37-24-12-5-13-25-37)38-26-14-6-15-27-38/h4-33,42-43,47H,34-35H2,1-3H3/t42-,43-/m1/s1 |
| InChIKey | LSCFVWSOYXSYJI-OCQXTOTRSA-N |
| XLogP | 10.27 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.94 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|