C21H16BrNO2 — CID 135054503
(2R,3S)-3-(3-bromophenyl)-N,N-diphenyloxirane-2-carboxamide (PubChem CID 135054503) has the molecular formula C21H16BrNO2 and a molecular weight of 394.27 g/mol. Its IUPAC name is (2R,3S)-3-(3-bromophenyl)-N,N-diphenyloxirane-2-carboxamide.
| Compound Name | (2R,3S)-3-(3-bromophenyl)-N,N-diphenyloxirane-2-carboxamide |
|---|---|
| PubChem CID | 135054503 |
| Molecular Formula | C21H16BrNO2 |
| Molecular Weight | 394.27 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | (2R,3S)-3-(3-bromophenyl)-N,N-diphenyloxirane-2-carboxamide |
| SMILES | O=C([C@@H]1O[C@H]1c1cccc(Br)c1)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H16BrNO2/c22-16-9-7-8-15(14-16)19-20(25-19)21(24)23(17-10-3-1-4-11-17)18-12-5-2-6-13-18/h1-14,19-20H/t19-,20+/m0/s1 |
| InChIKey | UUHGYEIVBJLMPF-VQTJNVASSA-N |
| XLogP | 5.25 |
| TPSA | 32.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.27 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|