C20H29ClO3Si — CID 135054564
methyl (2S,3S,4E)-3-[tert-butyl(dimethyl)silyl]oxy-2-(4-chlorophenyl)hepta-4,6-dienoate (PubChem CID 135054564) has the molecular formula C20H29ClO3Si and a molecular weight of 380.99 g/mol. Its IUPAC name is methyl (2S,3S,4E)-3-[tert-butyl(dimethyl)silyl]oxy-2-(4-chlorophenyl)hepta-4,6-dienoate.
| Compound Name | methyl (2S,3S,4E)-3-[tert-butyl(dimethyl)silyl]oxy-2-(4-chlorophenyl)hepta-4,6-dienoate |
|---|---|
| PubChem CID | 135054564 |
| Molecular Formula | C20H29ClO3Si |
| Molecular Weight | 380.99 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | methyl (2S,3S,4E)-3-[tert-butyl(dimethyl)silyl]oxy-2-(4-chlorophenyl)hepta-4,6-dienoate |
| SMILES | C=C/C=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C(=O)OC)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H29ClO3Si/c1-8-9-10-17(24-25(6,7)20(2,3)4)18(19(22)23-5)15-11-13-16(21)14-12-15/h8-14,17-18H,1H2,2-7H3/b10-9+/t17-,18-/m0/s1 |
| InChIKey | UNSPBWCFYCKYKQ-VCVRMXLYSA-N |
| XLogP | 5.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.99 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|