About methyl (E,2S)-2-acetamido-6,6-dimethylhept-4-enoate
methyl (E,2S)-2-acetamido-6,6-dimethylhept-4-enoate (PubChem CID 135054617) has the molecular formula C12H21NO3
and a molecular weight of 227.30 g/mol. Its IUPAC name is methyl (E,2S)-2-acetamido-6,6-dimethylhept-4-enoate.
Molecular Properties
| Compound Name | methyl (E,2S)-2-acetamido-6,6-dimethylhept-4-enoate |
| PubChem CID | 135054617 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | methyl (E,2S)-2-acetamido-6,6-dimethylhept-4-enoate |
| SMILES | COC(=O)[C@H](C/C=C/C(C)(C)C)NC(C)=O |
| InChI | InChI=1S/C12H21NO3/c1-9(14)13-10(11(15)16-5)7-6-8-12(2,3)4/h6,8,10H,7H2,1-5H3,(H,13,14)/b8-6+/t10-/m0/s1 |
| InChIKey | ZWDNSQDXLDPEFF-PCGIRMHASA-N |
| XLogP | 1.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl (E,2S)-2-acetamido-6,6-dimethylhept-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E,2S)-2-acetamido-6,6-dimethylhept-4-enoate?
The IUPAC name of methyl (E,2S)-2-acetamido-6,6-dimethylhept-4-enoate (CID 135054617) is methyl (E,2S)-2-acetamido-6,6-dimethylhept-4-enoate.
What is the SMILES notation for methyl (E,2S)-2-acetamido-6,6-dimethylhept-4-enoate?
The canonical SMILES for methyl (E,2S)-2-acetamido-6,6-dimethylhept-4-enoate is COC(=O)[C@H](C/C=C/C(C)(C)C)NC(C)=O.
What is the InChIKey of methyl (E,2S)-2-acetamido-6,6-dimethylhept-4-enoate?
The InChIKey is ZWDNSQDXLDPEFF-PCGIRMHASA-N. The full InChI is InChI=1S/C12H21NO3/c1-9(14)13-10(11(15)16-5)7-6-8-12(2,3)4/h6,8,10H,7H2,1-5H3,(H,13,14)/b8-6+/t10-/m0/s1.
What are the key properties of methyl (E,2S)-2-acetamido-6,6-dimethylhept-4-enoate?
methyl (E,2S)-2-acetamido-6,6-dimethylhept-4-enoate has a molecular weight of 227.30 g/mol, XLogP of 1.66, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E,2S)-2-acetamido-6,6-dimethylhept-4-enoate is sourced from PubChem (CID 135054617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).