About ethyl (4R,6R)-6-[(Z)-hex-3-enyl]-2,4-dihydroxy-3-methylidenecyclohexene-1-carboxylate
ethyl (4R,6R)-6-[(Z)-hex-3-enyl]-2,4-dihydroxy-3-methylidenecyclohexene-1-carboxylate (PubChem CID 135054631) has the molecular formula C16H24O4
and a molecular weight of 280.36 g/mol. Its IUPAC name is ethyl (4R,6R)-6-[(Z)-hex-3-enyl]-2,4-dihydroxy-3-methylidenecyclohexene-1-carboxylate.
Molecular Properties
| Compound Name | ethyl (4R,6R)-6-[(Z)-hex-3-enyl]-2,4-dihydroxy-3-methylidenecyclohexene-1-carboxylate |
| PubChem CID | 135054631 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | ethyl (4R,6R)-6-[(Z)-hex-3-enyl]-2,4-dihydroxy-3-methylidenecyclohexene-1-carboxylate |
| SMILES | C=C1C(O)=C(C(=O)OCC)[C@H](CC/C=C\CC)C[C@H]1O |
| InChI | InChI=1S/C16H24O4/c1-4-6-7-8-9-12-10-13(17)11(3)15(18)14(12)16(19)20-5-2/h6-7,12-13,17-18H,3-5,8-10H2,1-2H3/b7-6-/t12-,13-/m1/s1 |
| InChIKey | ZZDVSOZJKKJCRW-ZSBJFDRYSA-N |
| XLogP | 3.05 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl (4R,6R)-6-[(Z)-hex-3-enyl]-2,4-dihydroxy-3-methylidenecyclohexene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (4R,6R)-6-[(Z)-hex-3-enyl]-2,4-dihydroxy-3-methylidenecyclohexene-1-carboxylate?
The IUPAC name of ethyl (4R,6R)-6-[(Z)-hex-3-enyl]-2,4-dihydroxy-3-methylidenecyclohexene-1-carboxylate (CID 135054631) is ethyl (4R,6R)-6-[(Z)-hex-3-enyl]-2,4-dihydroxy-3-methylidenecyclohexene-1-carboxylate.
What is the SMILES notation for ethyl (4R,6R)-6-[(Z)-hex-3-enyl]-2,4-dihydroxy-3-methylidenecyclohexene-1-carboxylate?
The canonical SMILES for ethyl (4R,6R)-6-[(Z)-hex-3-enyl]-2,4-dihydroxy-3-methylidenecyclohexene-1-carboxylate is C=C1C(O)=C(C(=O)OCC)[C@H](CC/C=C\CC)C[C@H]1O.
What is the InChIKey of ethyl (4R,6R)-6-[(Z)-hex-3-enyl]-2,4-dihydroxy-3-methylidenecyclohexene-1-carboxylate?
The InChIKey is ZZDVSOZJKKJCRW-ZSBJFDRYSA-N. The full InChI is InChI=1S/C16H24O4/c1-4-6-7-8-9-12-10-13(17)11(3)15(18)14(12)16(19)20-5-2/h6-7,12-13,17-18H,3-5,8-10H2,1-2H3/b7-6-/t12-,13-/m1/s1.
What are the key properties of ethyl (4R,6R)-6-[(Z)-hex-3-enyl]-2,4-dihydroxy-3-methylidenecyclohexene-1-carboxylate?
ethyl (4R,6R)-6-[(Z)-hex-3-enyl]-2,4-dihydroxy-3-methylidenecyclohexene-1-carboxylate has a molecular weight of 280.36 g/mol, XLogP of 3.05, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (4R,6R)-6-[(Z)-hex-3-enyl]-2,4-dihydroxy-3-methylidenecyclohexene-1-carboxylate is sourced from PubChem (CID 135054631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).