About (3R,5R)-5-ethoxy-2-phenyl-3-[4-(trifluoromethyl)phenyl]-1,2-oxazolidine
(3R,5R)-5-ethoxy-2-phenyl-3-[4-(trifluoromethyl)phenyl]-1,2-oxazolidine (PubChem CID 135054650) has the molecular formula C18H18F3NO2
and a molecular weight of 337.34 g/mol. Its IUPAC name is (3R,5R)-5-ethoxy-2-phenyl-3-[4-(trifluoromethyl)phenyl]-1,2-oxazolidine.
Molecular Properties
| Compound Name | (3R,5R)-5-ethoxy-2-phenyl-3-[4-(trifluoromethyl)phenyl]-1,2-oxazolidine |
| PubChem CID | 135054650 |
| Molecular Formula | C18H18F3NO2 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | (3R,5R)-5-ethoxy-2-phenyl-3-[4-(trifluoromethyl)phenyl]-1,2-oxazolidine |
| SMILES | CCO[C@H]1C[C@H](c2ccc(C(F)(F)F)cc2)N(c2ccccc2)O1 |
| InChI | InChI=1S/C18H18F3NO2/c1-2-23-17-12-16(22(24-17)15-6-4-3-5-7-15)13-8-10-14(11-9-13)18(19,20)21/h3-11,16-17H,2,12H2,1H3/t16-,17-/m1/s1 |
| InChIKey | DXOQUDFAVGTHSQ-IAGOWNOFSA-N |
| XLogP | 4.95 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R,5R)-5-ethoxy-2-phenyl-3-[4-(trifluoromethyl)phenyl]-1,2-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,5R)-5-ethoxy-2-phenyl-3-[4-(trifluoromethyl)phenyl]-1,2-oxazolidine?
The IUPAC name of (3R,5R)-5-ethoxy-2-phenyl-3-[4-(trifluoromethyl)phenyl]-1,2-oxazolidine (CID 135054650) is (3R,5R)-5-ethoxy-2-phenyl-3-[4-(trifluoromethyl)phenyl]-1,2-oxazolidine.
What is the SMILES notation for (3R,5R)-5-ethoxy-2-phenyl-3-[4-(trifluoromethyl)phenyl]-1,2-oxazolidine?
The canonical SMILES for (3R,5R)-5-ethoxy-2-phenyl-3-[4-(trifluoromethyl)phenyl]-1,2-oxazolidine is CCO[C@H]1C[C@H](c2ccc(C(F)(F)F)cc2)N(c2ccccc2)O1.
What is the InChIKey of (3R,5R)-5-ethoxy-2-phenyl-3-[4-(trifluoromethyl)phenyl]-1,2-oxazolidine?
The InChIKey is DXOQUDFAVGTHSQ-IAGOWNOFSA-N. The full InChI is InChI=1S/C18H18F3NO2/c1-2-23-17-12-16(22(24-17)15-6-4-3-5-7-15)13-8-10-14(11-9-13)18(19,20)21/h3-11,16-17H,2,12H2,1H3/t16-,17-/m1/s1.
What are the key properties of (3R,5R)-5-ethoxy-2-phenyl-3-[4-(trifluoromethyl)phenyl]-1,2-oxazolidine?
(3R,5R)-5-ethoxy-2-phenyl-3-[4-(trifluoromethyl)phenyl]-1,2-oxazolidine has a molecular weight of 337.34 g/mol, XLogP of 4.95, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5R)-5-ethoxy-2-phenyl-3-[4-(trifluoromethyl)phenyl]-1,2-oxazolidine is sourced from PubChem (CID 135054650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).