About tert-butyl N-[(1S,2S)-2-nitro-1-phenylheptyl]carbamate
tert-butyl N-[(1S,2S)-2-nitro-1-phenylheptyl]carbamate (PubChem CID 135054663) has the molecular formula C18H28N2O4
and a molecular weight of 336.43 g/mol. Its IUPAC name is tert-butyl N-[(1S,2S)-2-nitro-1-phenylheptyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(1S,2S)-2-nitro-1-phenylheptyl]carbamate |
| PubChem CID | 135054663 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | tert-butyl N-[(1S,2S)-2-nitro-1-phenylheptyl]carbamate |
| SMILES | CCCCC[C@@H]([C@@H](NC(=O)OC(C)(C)C)c1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C18H28N2O4/c1-5-6-8-13-15(20(22)23)16(14-11-9-7-10-12-14)19-17(21)24-18(2,3)4/h7,9-12,15-16H,5-6,8,13H2,1-4H3,(H,19,21)/t15-,16-/m0/s1 |
| InChIKey | DKZQLNZZNLZRFP-HOTGVXAUSA-N |
| XLogP | 4.48 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(1S,2S)-2-nitro-1-phenylheptyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(1S,2S)-2-nitro-1-phenylheptyl]carbamate?
The IUPAC name of tert-butyl N-[(1S,2S)-2-nitro-1-phenylheptyl]carbamate (CID 135054663) is tert-butyl N-[(1S,2S)-2-nitro-1-phenylheptyl]carbamate.
What is the SMILES notation for tert-butyl N-[(1S,2S)-2-nitro-1-phenylheptyl]carbamate?
The canonical SMILES for tert-butyl N-[(1S,2S)-2-nitro-1-phenylheptyl]carbamate is CCCCC[C@@H]([C@@H](NC(=O)OC(C)(C)C)c1ccccc1)[N+](=O)[O-].
What is the InChIKey of tert-butyl N-[(1S,2S)-2-nitro-1-phenylheptyl]carbamate?
The InChIKey is DKZQLNZZNLZRFP-HOTGVXAUSA-N. The full InChI is InChI=1S/C18H28N2O4/c1-5-6-8-13-15(20(22)23)16(14-11-9-7-10-12-14)19-17(21)24-18(2,3)4/h7,9-12,15-16H,5-6,8,13H2,1-4H3,(H,19,21)/t15-,16-/m0/s1.
What are the key properties of tert-butyl N-[(1S,2S)-2-nitro-1-phenylheptyl]carbamate?
tert-butyl N-[(1S,2S)-2-nitro-1-phenylheptyl]carbamate has a molecular weight of 336.43 g/mol, XLogP of 4.48, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(1S,2S)-2-nitro-1-phenylheptyl]carbamate is sourced from PubChem (CID 135054663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).