C13H27NO3 — CID 135054683
tert-butyl N-[(2R,3R)-1-hydroxy-2,5-dimethylhexan-3-yl]carbamate (PubChem CID 135054683) has the molecular formula C13H27NO3 and a molecular weight of 245.36 g/mol. Its IUPAC name is tert-butyl N-[(2R,3R)-1-hydroxy-2,5-dimethylhexan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3R)-1-hydroxy-2,5-dimethylhexan-3-yl]carbamate |
|---|---|
| PubChem CID | 135054683 |
| Molecular Formula | C13H27NO3 |
| Molecular Weight | 245.36 g/mol |
| Exact Mass | 245.20 |
| IUPAC Name | tert-butyl N-[(2R,3R)-1-hydroxy-2,5-dimethylhexan-3-yl]carbamate |
| SMILES | CC(C)C[C@@H](NC(=O)OC(C)(C)C)[C@@H](C)CO |
| InChI | InChI=1S/C13H27NO3/c1-9(2)7-11(10(3)8-15)14-12(16)17-13(4,5)6/h9-11,15H,7-8H2,1-6H3,(H,14,16)/t10-,11+/m0/s1 |
| InChIKey | QCYOCDLJCCHYGW-WDEREUQCSA-N |
| XLogP | 2.55 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |