C32H32F6N2O3 — CID 135054711
methyl (2R)-3-[bis(prop-2-enyl)amino]-2-[bis[4-(trifluoromethyl)phenyl]methylamino]-3-(4-methoxyphenyl)propanoate (PubChem CID 135054711) has the molecular formula C32H32F6N2O3 and a molecular weight of 606.61 g/mol. Its IUPAC name is methyl (2R)-3-[bis(prop-2-enyl)amino]-2-[bis[4-(trifluoromethyl)phenyl]methylamino]-3-(4-methoxyphenyl)propanoate.
| Compound Name | methyl (2R)-3-[bis(prop-2-enyl)amino]-2-[bis[4-(trifluoromethyl)phenyl]methylamino]-3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 135054711 |
| Molecular Formula | C32H32F6N2O3 |
| Molecular Weight | 606.61 g/mol |
| Exact Mass | 606.23 |
| IUPAC Name | methyl (2R)-3-[bis(prop-2-enyl)amino]-2-[bis[4-(trifluoromethyl)phenyl]methylamino]-3-(4-methoxyphenyl)propanoate |
| SMILES | C=CCN(CC=C)C(c1ccc(OC)cc1)[C@@H](NC(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1)C(=O)OC |
| InChI | InChI=1S/C32H32F6N2O3/c1-5-19-40(20-6-2)29(23-11-17-26(42-3)18-12-23)28(30(41)43-4)39-27(21-7-13-24(14-8-21)31(33,34)35)22-9-15-25(16-10-22)32(36,37)38/h5-18,27-29,39H,1-2,19-20H2,3-4H3/t28-,29?/m1/s1 |
| InChIKey | BGNKGGOMYPSPEN-FICMROCWSA-N |
| XLogP | 7.37 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.61 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|