C21H25F3O5 — CID 135054880
trifluoromethyl 4-[(1R,2S)-2-(2,4-dimethylpentan-3-yloxycarbonyl)-3-oxocyclopentyl]benzoate (PubChem CID 135054880) has the molecular formula C21H25F3O5 and a molecular weight of 414.42 g/mol. Its IUPAC name is trifluoromethyl 4-[(1R,2S)-2-(2,4-dimethylpentan-3-yloxycarbonyl)-3-oxocyclopentyl]benzoate.
| Compound Name | trifluoromethyl 4-[(1R,2S)-2-(2,4-dimethylpentan-3-yloxycarbonyl)-3-oxocyclopentyl]benzoate |
|---|---|
| PubChem CID | 135054880 |
| Molecular Formula | C21H25F3O5 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | trifluoromethyl 4-[(1R,2S)-2-(2,4-dimethylpentan-3-yloxycarbonyl)-3-oxocyclopentyl]benzoate |
| SMILES | CC(C)C(OC(=O)[C@@H]1C(=O)CC[C@H]1c1ccc(C(=O)OC(F)(F)F)cc1)C(C)C |
| InChI | InChI=1S/C21H25F3O5/c1-11(2)18(12(3)4)28-20(27)17-15(9-10-16(17)25)13-5-7-14(8-6-13)19(26)29-21(22,23)24/h5-8,11-12,15,17-18H,9-10H2,1-4H3/t15-,17-/m0/s1 |
| InChIKey | BYVYOCOKLLIFNP-RDJZCZTQSA-N |
| XLogP | 4.65 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|