C24H43NO3Si — CID 135055008
(2R)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,2-dimethyl-4-tri(propan-2-yl)silyloxybutanamide (PubChem CID 135055008) has the molecular formula C24H43NO3Si and a molecular weight of 421.70 g/mol. Its IUPAC name is (2R)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,2-dimethyl-4-tri(propan-2-yl)silyloxybutanamide.
| Compound Name | (2R)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,2-dimethyl-4-tri(propan-2-yl)silyloxybutanamide |
|---|---|
| PubChem CID | 135055008 |
| Molecular Formula | C24H43NO3Si |
| Molecular Weight | 421.70 g/mol |
| Exact Mass | 421.30 |
| IUPAC Name | (2R)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,2-dimethyl-4-tri(propan-2-yl)silyloxybutanamide |
| SMILES | CC(C)[Si](OCC[C@@H](C)C(=O)N(C)[C@@H](C)[C@@H](O)c1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H43NO3Si/c1-17(2)29(18(3)4,19(5)6)28-16-15-20(7)24(27)25(9)21(8)23(26)22-13-11-10-12-14-22/h10-14,17-21,23,26H,15-16H2,1-9H3/t20-,21+,23-/m1/s1 |
| InChIKey | FPJTVQWESHXEIY-FUPPJEDESA-N |
| XLogP | 5.79 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.70 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|