About [(4R,5R)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-nitro-5-phenylpentyl] methanesulfonate
[(4R,5R)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-nitro-5-phenylpentyl] methanesulfonate (PubChem CID 135055063) has the molecular formula C17H26N2O7S
and a molecular weight of 402.47 g/mol. Its IUPAC name is [(4R,5R)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-nitro-5-phenylpentyl] methanesulfonate.
Molecular Properties
| Compound Name | [(4R,5R)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-nitro-5-phenylpentyl] methanesulfonate |
| PubChem CID | 135055063 |
| Molecular Formula | C17H26N2O7S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | [(4R,5R)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-nitro-5-phenylpentyl] methanesulfonate |
| SMILES | CC(C)(C)OC(=O)N[C@H](c1ccccc1)[C@@H](CCCOS(C)(=O)=O)[N+](=O)[O-] |
| InChI | InChI=1S/C17H26N2O7S/c1-17(2,3)26-16(20)18-15(13-9-6-5-7-10-13)14(19(21)22)11-8-12-25-27(4,23)24/h5-7,9-10,14-15H,8,11-12H2,1-4H3,(H,18,20)/t14-,15-/m1/s1 |
| InChIKey | YVUFTTVRGBZBGZ-HUUCEWRRSA-N |
| XLogP | 2.65 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(4R,5R)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-nitro-5-phenylpentyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4R,5R)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-nitro-5-phenylpentyl] methanesulfonate?
The IUPAC name of [(4R,5R)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-nitro-5-phenylpentyl] methanesulfonate (CID 135055063) is [(4R,5R)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-nitro-5-phenylpentyl] methanesulfonate.
What is the SMILES notation for [(4R,5R)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-nitro-5-phenylpentyl] methanesulfonate?
The canonical SMILES for [(4R,5R)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-nitro-5-phenylpentyl] methanesulfonate is CC(C)(C)OC(=O)N[C@H](c1ccccc1)[C@@H](CCCOS(C)(=O)=O)[N+](=O)[O-].
What is the InChIKey of [(4R,5R)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-nitro-5-phenylpentyl] methanesulfonate?
The InChIKey is YVUFTTVRGBZBGZ-HUUCEWRRSA-N. The full InChI is InChI=1S/C17H26N2O7S/c1-17(2,3)26-16(20)18-15(13-9-6-5-7-10-13)14(19(21)22)11-8-12-25-27(4,23)24/h5-7,9-10,14-15H,8,11-12H2,1-4H3,(H,18,20)/t14-,15-/m1/s1.
What are the key properties of [(4R,5R)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-nitro-5-phenylpentyl] methanesulfonate?
[(4R,5R)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-nitro-5-phenylpentyl] methanesulfonate has a molecular weight of 402.47 g/mol, XLogP of 2.65, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(4R,5R)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-nitro-5-phenylpentyl] methanesulfonate is sourced from PubChem (CID 135055063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).