C17H27NO — CID 135055210
(6Z,9Z,10aS)-7-hexyl-9-methyl-2,3,8,10a-tetrahydro-1H-pyrrolo[1,2-a]azocin-5-one (PubChem CID 135055210) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is (6Z,9Z,10aS)-7-hexyl-9-methyl-2,3,8,10a-tetrahydro-1H-pyrrolo[1,2-a]azocin-5-one.
| Compound Name | (6Z,9Z,10aS)-7-hexyl-9-methyl-2,3,8,10a-tetrahydro-1H-pyrrolo[1,2-a]azocin-5-one |
|---|---|
| PubChem CID | 135055210 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | (6Z,9Z,10aS)-7-hexyl-9-methyl-2,3,8,10a-tetrahydro-1H-pyrrolo[1,2-a]azocin-5-one |
| SMILES | CCCCCC/C1=C/C(=O)N2CCC[C@H]2/C=C(/C)C1 |
| InChI | InChI=1S/C17H27NO/c1-3-4-5-6-8-15-11-14(2)12-16-9-7-10-18(16)17(19)13-15/h12-13,16H,3-11H2,1-2H3/b14-12-,15-13-/t16-/m0/s1 |
| InChIKey | IROBQTKBPQXYKE-QLPDXPFNSA-N |
| XLogP | 4.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|