C20H19F3O3 — CID 135055354
ethyl (2R)-2-hydroxy-4-(4-phenylphenyl)-2-(trifluoromethyl)pent-4-enoate (PubChem CID 135055354) has the molecular formula C20H19F3O3 and a molecular weight of 364.36 g/mol. Its IUPAC name is ethyl (2R)-2-hydroxy-4-(4-phenylphenyl)-2-(trifluoromethyl)pent-4-enoate.
| Compound Name | ethyl (2R)-2-hydroxy-4-(4-phenylphenyl)-2-(trifluoromethyl)pent-4-enoate |
|---|---|
| PubChem CID | 135055354 |
| Molecular Formula | C20H19F3O3 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | ethyl (2R)-2-hydroxy-4-(4-phenylphenyl)-2-(trifluoromethyl)pent-4-enoate |
| SMILES | C=C(C[C@@](O)(C(=O)OCC)C(F)(F)F)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H19F3O3/c1-3-26-18(24)19(25,20(21,22)23)13-14(2)15-9-11-17(12-10-15)16-7-5-4-6-8-16/h4-12,25H,2-3,13H2,1H3/t19-/m1/s1 |
| InChIKey | GJSGNYVSJNTPHE-LJQANCHMSA-N |
| XLogP | 4.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |