C11H23NO2 — CID 135055401
(2S,3S)-N,N-diethyl-3-hydroxy-2,4-dimethylpentanamide (PubChem CID 135055401) has the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is (2S,3S)-N,N-diethyl-3-hydroxy-2,4-dimethylpentanamide.
| Compound Name | (2S,3S)-N,N-diethyl-3-hydroxy-2,4-dimethylpentanamide |
|---|---|
| PubChem CID | 135055401 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | (2S,3S)-N,N-diethyl-3-hydroxy-2,4-dimethylpentanamide |
| SMILES | CCN(CC)C(=O)[C@@H](C)[C@@H](O)C(C)C |
| InChI | InChI=1S/C11H23NO2/c1-6-12(7-2)11(14)9(5)10(13)8(3)4/h8-10,13H,6-7H2,1-5H3/t9-,10-/m0/s1 |
| InChIKey | FYGFPOZYVOJEJR-UWVGGRQHSA-N |
| XLogP | 1.51 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |