C42H40O12S2 — CID 135055526
(2S,3S)-2,3-dibenzoyloxy-4-[4-[(1S)-4,4-bis(benzenesulfonyl)-2-methylidenecyclohexyl]pent-4-enoxy]-4-oxobutanoic acid (PubChem CID 135055526) has the molecular formula C42H40O12S2 and a molecular weight of 800.90 g/mol. Its IUPAC name is (2S,3S)-2,3-dibenzoyloxy-4-[4-[(1S)-4,4-bis(benzenesulfonyl)-2-methylidenecyclohexyl]pent-4-enoxy]-4-oxobutanoic acid.
| Compound Name | (2S,3S)-2,3-dibenzoyloxy-4-[4-[(1S)-4,4-bis(benzenesulfonyl)-2-methylidenecyclohexyl]pent-4-enoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 135055526 |
| Molecular Formula | C42H40O12S2 |
| Molecular Weight | 800.90 g/mol |
| Exact Mass | 800.20 |
| IUPAC Name | (2S,3S)-2,3-dibenzoyloxy-4-[4-[(1S)-4,4-bis(benzenesulfonyl)-2-methylidenecyclohexyl]pent-4-enoxy]-4-oxobutanoic acid |
| SMILES | C=C(CCCOC(=O)[C@@H](OC(=O)c1ccccc1)[C@H](OC(=O)c1ccccc1)C(=O)O)[C@@H]1CCC(S(=O)(=O)c2ccccc2)(S(=O)(=O)c2ccccc2)CC1=C |
| InChI | InChI=1S/C42H40O12S2/c1-29(35-25-26-42(28-30(35)2,55(48,49)33-21-11-5-12-22-33)56(50,51)34-23-13-6-14-24-34)16-15-27-52-41(47)37(54-40(46)32-19-9-4-10-20-32)36(38(43)44)53-39(45)31-17-7-3-8-18-31/h3-14,17-24,35-37H,1-2,15-16,25-28H2,(H,43,44)/t35-,36-,37-/m0/s1 |
| InChIKey | GETDHRDFZFZVQY-FSEITFBQSA-N |
| XLogP | 6.40 |
| TPSA | 184.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.90 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|