C17H21ClO3 — CID 135055691
methyl (1S,4aS,10aR)-6-chloro-1-hydroxy-4a-methyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate (PubChem CID 135055691) has the molecular formula C17H21ClO3 and a molecular weight of 308.80 g/mol. Its IUPAC name is methyl (1S,4aS,10aR)-6-chloro-1-hydroxy-4a-methyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate.
| Compound Name | methyl (1S,4aS,10aR)-6-chloro-1-hydroxy-4a-methyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 135055691 |
| Molecular Formula | C17H21ClO3 |
| Molecular Weight | 308.80 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | methyl (1S,4aS,10aR)-6-chloro-1-hydroxy-4a-methyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
| SMILES | COC(=O)[C@]1(O)CCC[C@]2(C)c3cc(Cl)ccc3CC[C@@H]12 |
| InChI | InChI=1S/C17H21ClO3/c1-16-8-3-9-17(20,15(19)21-2)14(16)7-5-11-4-6-12(18)10-13(11)16/h4,6,10,14,20H,3,5,7-9H2,1-2H3/t14-,16-,17+/m1/s1 |
| InChIKey | MOWWUPCNGBDIRF-OIISXLGYSA-N |
| XLogP | 3.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.80 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |