About (R)-N-[(1R,2S)-1-(benzenesulfonyl)-1-fluoropentan-2-yl]-2-methylpropane-2-sulfinamide
(R)-N-[(1R,2S)-1-(benzenesulfonyl)-1-fluoropentan-2-yl]-2-methylpropane-2-sulfinamide (PubChem CID 135055719) has the molecular formula C15H24FNO3S2
and a molecular weight of 349.49 g/mol. Its IUPAC name is (R)-N-[(1R,2S)-1-(benzenesulfonyl)-1-fluoropentan-2-yl]-2-methylpropane-2-sulfinamide.
Molecular Properties
| Compound Name | (R)-N-[(1R,2S)-1-(benzenesulfonyl)-1-fluoropentan-2-yl]-2-methylpropane-2-sulfinamide |
| PubChem CID | 135055719 |
| Molecular Formula | C15H24FNO3S2 |
| Molecular Weight | 349.49 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | (R)-N-[(1R,2S)-1-(benzenesulfonyl)-1-fluoropentan-2-yl]-2-methylpropane-2-sulfinamide |
| SMILES | CCC[C@H](N[S@](=O)C(C)(C)C)[C@H](F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H24FNO3S2/c1-5-9-13(17-21(18)15(2,3)4)14(16)22(19,20)12-10-7-6-8-11-12/h6-8,10-11,13-14,17H,5,9H2,1-4H3/t13-,14+,21+/m0/s1 |
| InChIKey | AGXQPYKRIPPKBS-PXIJXODZSA-N |
| XLogP | 2.98 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (R)-N-[(1R,2S)-1-(benzenesulfonyl)-1-fluoropentan-2-yl]-2-methylpropane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (R)-N-[(1R,2S)-1-(benzenesulfonyl)-1-fluoropentan-2-yl]-2-methylpropane-2-sulfinamide?
The IUPAC name of (R)-N-[(1R,2S)-1-(benzenesulfonyl)-1-fluoropentan-2-yl]-2-methylpropane-2-sulfinamide (CID 135055719) is (R)-N-[(1R,2S)-1-(benzenesulfonyl)-1-fluoropentan-2-yl]-2-methylpropane-2-sulfinamide.
What is the SMILES notation for (R)-N-[(1R,2S)-1-(benzenesulfonyl)-1-fluoropentan-2-yl]-2-methylpropane-2-sulfinamide?
The canonical SMILES for (R)-N-[(1R,2S)-1-(benzenesulfonyl)-1-fluoropentan-2-yl]-2-methylpropane-2-sulfinamide is CCC[C@H](N[S@](=O)C(C)(C)C)[C@H](F)S(=O)(=O)c1ccccc1.
What is the InChIKey of (R)-N-[(1R,2S)-1-(benzenesulfonyl)-1-fluoropentan-2-yl]-2-methylpropane-2-sulfinamide?
The InChIKey is AGXQPYKRIPPKBS-PXIJXODZSA-N. The full InChI is InChI=1S/C15H24FNO3S2/c1-5-9-13(17-21(18)15(2,3)4)14(16)22(19,20)12-10-7-6-8-11-12/h6-8,10-11,13-14,17H,5,9H2,1-4H3/t13-,14+,21+/m0/s1.
What are the key properties of (R)-N-[(1R,2S)-1-(benzenesulfonyl)-1-fluoropentan-2-yl]-2-methylpropane-2-sulfinamide?
(R)-N-[(1R,2S)-1-(benzenesulfonyl)-1-fluoropentan-2-yl]-2-methylpropane-2-sulfinamide has a molecular weight of 349.49 g/mol, XLogP of 2.98, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (R)-N-[(1R,2S)-1-(benzenesulfonyl)-1-fluoropentan-2-yl]-2-methylpropane-2-sulfinamide is sourced from PubChem (CID 135055719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).