C23H20ClF6NO4P2 — CID 135055735
(1R)-1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-1-(4-chlorophenyl)-N-diphenylphosphorylmethanamine (PubChem CID 135055735) has the molecular formula C23H20ClF6NO4P2 and a molecular weight of 585.81 g/mol. Its IUPAC name is (1R)-1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-1-(4-chlorophenyl)-N-diphenylphosphorylmethanamine.
| Compound Name | (1R)-1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-1-(4-chlorophenyl)-N-diphenylphosphorylmethanamine |
|---|---|
| PubChem CID | 135055735 |
| Molecular Formula | C23H20ClF6NO4P2 |
| Molecular Weight | 585.81 g/mol |
| Exact Mass | 585.05 |
| IUPAC Name | (1R)-1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-1-(4-chlorophenyl)-N-diphenylphosphorylmethanamine |
| SMILES | O=P(N[C@@H](c1ccc(Cl)cc1)P(=O)(OCC(F)(F)F)OCC(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H20ClF6NO4P2/c24-18-13-11-17(12-14-18)21(37(33,34-15-22(25,26)27)35-16-23(28,29)30)31-36(32,19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-14,21H,15-16H2,(H,31,32)/t21-/m1/s1 |
| InChIKey | KLSDZCCLAGQFNU-OAQYLSRUSA-N |
| XLogP | 7.21 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.81 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|