C16H22O8 — CID 135055818
6-O,6-O'-diethyl 7-O-methyl (3aR)-3a-methyl-3,4-dihydro-1H-furo[3,4-c]pyran-6,6,7-tricarboxylate (PubChem CID 135055818) has the molecular formula C16H22O8 and a molecular weight of 342.34 g/mol. Its IUPAC name is 6-O,6-O'-diethyl 7-O-methyl (3aR)-3a-methyl-3,4-dihydro-1H-furo[3,4-c]pyran-6,6,7-tricarboxylate.
| Compound Name | 6-O,6-O'-diethyl 7-O-methyl (3aR)-3a-methyl-3,4-dihydro-1H-furo[3,4-c]pyran-6,6,7-tricarboxylate |
|---|---|
| PubChem CID | 135055818 |
| Molecular Formula | C16H22O8 |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 6-O,6-O'-diethyl 7-O-methyl (3aR)-3a-methyl-3,4-dihydro-1H-furo[3,4-c]pyran-6,6,7-tricarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)OC[C@@]2(C)COCC2=C1C(=O)OC |
| InChI | InChI=1S/C16H22O8/c1-5-22-13(18)16(14(19)23-6-2)11(12(17)20-4)10-7-21-8-15(10,3)9-24-16/h5-9H2,1-4H3/t15-/m1/s1 |
| InChIKey | XCDCKLSTQQNFSF-OAHLLOKOSA-N |
| XLogP | 0.39 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|