C21H29NO3 — CID 135055922
[(3R,8bR)-8b-methyl-2,3,3a,4-tetrahydro-1H-cyclopenta[a]inden-3-yl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 135055922) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is [(3R,8bR)-8b-methyl-2,3,3a,4-tetrahydro-1H-cyclopenta[a]inden-3-yl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | [(3R,8bR)-8b-methyl-2,3,3a,4-tetrahydro-1H-cyclopenta[a]inden-3-yl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 135055922 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | [(3R,8bR)-8b-methyl-2,3,3a,4-tetrahydro-1H-cyclopenta[a]inden-3-yl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC1(C)COC(C)(C)N1C(=O)O[C@@H]1CC[C@@]2(C)c3ccccc3CC12 |
| InChI | InChI=1S/C21H29NO3/c1-19(2)13-24-20(3,4)22(19)18(23)25-17-10-11-21(5)15-9-7-6-8-14(15)12-16(17)21/h6-9,16-17H,10-13H2,1-5H3/t16?,17-,21+/m1/s1 |
| InChIKey | KWWBSDWANMHPTH-IMPPOJTNSA-N |
| XLogP | 4.26 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |