C21H29NO3 — CID 135055925
3-[(1R)-1-methylinden-1-yl]propyl 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 135055925) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is 3-[(1R)-1-methylinden-1-yl]propyl 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | 3-[(1R)-1-methylinden-1-yl]propyl 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 135055925 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 3-[(1R)-1-methylinden-1-yl]propyl 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC1(C)COC(C)(C)N1C(=O)OCCC[C@]1(C)C=Cc2ccccc21 |
| InChI | InChI=1S/C21H29NO3/c1-19(2)15-25-20(3,4)22(19)18(23)24-14-8-12-21(5)13-11-16-9-6-7-10-17(16)21/h6-7,9-11,13H,8,12,14-15H2,1-5H3/t21-/m1/s1 |
| InChIKey | JIBJFBANEAERMI-OAQYLSRUSA-N |
| XLogP | 4.73 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|